C11H22F2N2O2 — CID 114154240
6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-ethylhexanamide (PubChem CID 114154240) has the molecular formula C11H22F2N2O2 and a molecular weight of 252.30 g/mol. Its IUPAC name is 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-ethylhexanamide.
| Compound Name | 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-ethylhexanamide |
|---|---|
| PubChem CID | 114154240 |
| Molecular Formula | C11H22F2N2O2 |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-ethylhexanamide |
| SMILES | CCC(CCN)CCC(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H22F2N2O2/c1-2-9(5-6-14)3-4-10(17)15-7-11(12,13)8-16/h9,16H,2-8,14H2,1H3,(H,15,17) |
| InChIKey | MWPORUNFJZCVOK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |