C12H16ClN5 — CID 114156495
6-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-propylpyrimidin-4-amine (PubChem CID 114156495) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is 6-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114156495 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NCc1cn[nH]c1C |
| InChI | InChI=1S/C12H16ClN5/c1-3-4-10-11(13)15-7-16-12(10)14-5-9-6-17-18-8(9)2/h6-7H,3-5H2,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | PZWPEOGGAOOSAE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |