C15H16ClN3O2 — CID 106194190
N-(1,3-benzodioxol-4-ylmethyl)-6-chloro-5-propylpyrimidin-4-amine (PubChem CID 106194190) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-6-chloro-5-propylpyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-6-chloro-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106194190 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-6-chloro-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C15H16ClN3O2/c1-2-4-11-14(16)18-8-19-15(11)17-7-10-5-3-6-12-13(10)21-9-20-12/h3,5-6,8H,2,4,7,9H2,1H3,(H,17,18,19) |
| InChIKey | BBTXURZUNPOFCG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |