C13H14ClN3S — CID 114156800
2-chloro-6-ethyl-N-pent-4-yn-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 114156800) has the molecular formula C13H14ClN3S and a molecular weight of 279.80 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-pent-4-yn-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-pent-4-yn-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114156800 |
| Molecular Formula | C13H14ClN3S |
| Molecular Weight | 279.80 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-chloro-6-ethyl-N-pent-4-yn-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C#CCC(C)Nc1nc(Cl)nc2sc(CC)cc12 |
| InChI | InChI=1S/C13H14ClN3S/c1-4-6-8(3)15-11-10-7-9(5-2)18-12(10)17-13(14)16-11/h1,7-8H,5-6H2,2-3H3,(H,15,16,17) |
| InChIKey | OKQXWCATJZXMMM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|