C14H17NOS — CID 114157448
2-(2-cyclobutylethoxy)-6-methylsulfanylbenzonitrile (PubChem CID 114157448) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-(2-cyclobutylethoxy)-6-methylsulfanylbenzonitrile.
| Compound Name | 2-(2-cyclobutylethoxy)-6-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 114157448 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(2-cyclobutylethoxy)-6-methylsulfanylbenzonitrile |
| SMILES | CSc1cccc(OCCC2CCC2)c1C#N |
| InChI | InChI=1S/C14H17NOS/c1-17-14-7-3-6-13(12(14)10-15)16-9-8-11-4-2-5-11/h3,6-7,11H,2,4-5,8-9H2,1H3 |
| InChIKey | PJMVZEMYMURGOD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |