C12H12F3NOS — CID 113385672
2-methylsulfanyl-6-(4,4,4-trifluorobutoxy)benzonitrile (PubChem CID 113385672) has the molecular formula C12H12F3NOS and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(4,4,4-trifluorobutoxy)benzonitrile.
| Compound Name | 2-methylsulfanyl-6-(4,4,4-trifluorobutoxy)benzonitrile |
|---|---|
| PubChem CID | 113385672 |
| Molecular Formula | C12H12F3NOS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-methylsulfanyl-6-(4,4,4-trifluorobutoxy)benzonitrile |
| SMILES | CSc1cccc(OCCCC(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H12F3NOS/c1-18-11-5-2-4-10(9(11)8-16)17-7-3-6-12(13,14)15/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | WCXIPHFWXHDNSI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|