C12H12BrF4N — CID 114158640
N-[1-(3-bromo-4-fluorophenyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 114158640) has the molecular formula C12H12BrF4N and a molecular weight of 326.13 g/mol. Its IUPAC name is N-[1-(3-bromo-4-fluorophenyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 114158640 |
| Molecular Formula | C12H12BrF4N |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC(NC1(C(F)(F)F)CC1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrF4N/c1-7(8-2-3-10(14)9(13)6-8)18-11(4-5-11)12(15,16)17/h2-3,6-7,18H,4-5H2,1H3 |
| InChIKey | KLGMXXACRIUAST-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |