C12H17N3O2 — CID 114160542
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]pent-1-yn-3-amine (PubChem CID 114160542) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]pent-1-yn-3-amine.
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 114160542 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NCc1c(OC)ncnc1OC |
| InChI | InChI=1S/C12H17N3O2/c1-5-9(6-2)13-7-10-11(16-3)14-8-15-12(10)17-4/h1,8-9,13H,6-7H2,2-4H3 |
| InChIKey | DHGJFAYMEQELFF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|