C11H14N2O4S2 — CID 114160694
2-N-pent-1-yn-3-ylbenzene-1,2-disulfonamide (PubChem CID 114160694) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-N-pent-1-yn-3-ylbenzene-1,2-disulfonamide.
| Compound Name | 2-N-pent-1-yn-3-ylbenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 114160694 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-N-pent-1-yn-3-ylbenzene-1,2-disulfonamide |
| SMILES | C#CC(CC)NS(=O)(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14N2O4S2/c1-3-9(4-2)13-19(16,17)11-8-6-5-7-10(11)18(12,14)15/h1,5-9,13H,4H2,2H3,(H2,12,14,15) |
| InChIKey | JNEGYLDBRLWEMI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|