C16H23N — CID 114160798
1-(3,4-diethylphenyl)hex-1-yn-3-amine (PubChem CID 114160798) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)hex-1-yn-3-amine.
| Compound Name | 1-(3,4-diethylphenyl)hex-1-yn-3-amine |
|---|---|
| PubChem CID | 114160798 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-(3,4-diethylphenyl)hex-1-yn-3-amine |
| SMILES | CCCC(N)C#Cc1ccc(CC)c(CC)c1 |
| InChI | InChI=1S/C16H23N/c1-4-7-16(17)11-9-13-8-10-14(5-2)15(6-3)12-13/h8,10,12,16H,4-7,17H2,1-3H3 |
| InChIKey | DCBXBUOBYPRORD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|