C16H23N — CID 106208997
6-(3,4-diethylphenyl)hex-5-yn-1-amine (PubChem CID 106208997) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 6-(3,4-diethylphenyl)hex-5-yn-1-amine.
| Compound Name | 6-(3,4-diethylphenyl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106208997 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 6-(3,4-diethylphenyl)hex-5-yn-1-amine |
| SMILES | CCc1ccc(C#CCCCCN)cc1CC |
| InChI | InChI=1S/C16H23N/c1-3-15-11-10-14(13-16(15)4-2)9-7-5-6-8-12-17/h10-11,13H,3-6,8,12,17H2,1-2H3 |
| InChIKey | DZXVDOXFUYUECM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|