C14H19NO2 — CID 106208844
6-(2,6-dimethoxyphenyl)hex-5-yn-1-amine (PubChem CID 106208844) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)hex-5-yn-1-amine.
| Compound Name | 6-(2,6-dimethoxyphenyl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106208844 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)hex-5-yn-1-amine |
| SMILES | COc1cccc(OC)c1C#CCCCCN |
| InChI | InChI=1S/C14H19NO2/c1-16-13-9-7-10-14(17-2)12(13)8-5-3-4-6-11-15/h7,9-10H,3-4,6,11,15H2,1-2H3 |
| InChIKey | QXUJJBGQEPSDPY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|