C11H11F2N — CID 106220097
5-(2,6-difluorophenyl)pent-4-yn-1-amine (PubChem CID 106220097) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)pent-4-yn-1-amine.
| Compound Name | 5-(2,6-difluorophenyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 106220097 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5-(2,6-difluorophenyl)pent-4-yn-1-amine |
| SMILES | NCCCC#Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2N/c12-10-6-4-7-11(13)9(10)5-2-1-3-8-14/h4,6-7H,1,3,8,14H2 |
| InChIKey | DKSCHXNGMBNITK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|