C12H12BrF2N — CID 106208884
6-(3-bromo-2,6-difluorophenyl)hex-5-yn-1-amine (PubChem CID 106208884) has the molecular formula C12H12BrF2N and a molecular weight of 288.13 g/mol. Its IUPAC name is 6-(3-bromo-2,6-difluorophenyl)hex-5-yn-1-amine.
| Compound Name | 6-(3-bromo-2,6-difluorophenyl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106208884 |
| Molecular Formula | C12H12BrF2N |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 6-(3-bromo-2,6-difluorophenyl)hex-5-yn-1-amine |
| SMILES | NCCCCC#Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H12BrF2N/c13-10-6-7-11(14)9(12(10)15)5-3-1-2-4-8-16/h6-7H,1-2,4,8,16H2 |
| InChIKey | ZOJXDVPGZQEMEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|