C9H6BrF2N — CID 106943181
3-(3-bromo-2,6-difluorophenyl)prop-2-yn-1-amine (PubChem CID 106943181) has the molecular formula C9H6BrF2N and a molecular weight of 246.05 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)prop-2-yn-1-amine.
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 106943181 |
| Molecular Formula | C9H6BrF2N |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)prop-2-yn-1-amine |
| SMILES | NCC#Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H6BrF2N/c10-7-3-4-8(11)6(9(7)12)2-1-5-13/h3-4H,5,13H2 |
| InChIKey | CZWKSFJGXHGNMG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|