C9H5F4N — CID 130993739
3-(2,3,4,5-tetrafluorophenyl)prop-2-yn-1-amine (PubChem CID 130993739) has the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. Its IUPAC name is 3-(2,3,4,5-tetrafluorophenyl)prop-2-yn-1-amine.
| Compound Name | 3-(2,3,4,5-tetrafluorophenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 130993739 |
| Molecular Formula | C9H5F4N |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 3-(2,3,4,5-tetrafluorophenyl)prop-2-yn-1-amine |
| SMILES | NCC#Cc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F4N/c10-6-4-5(2-1-3-14)7(11)9(13)8(6)12/h4H,3,14H2 |
| InChIKey | PNRXBNAFTMODFH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|