C14H5BrF4 — CID 71089903
1-bromo-3-[2-(2,4-difluorophenyl)ethynyl]-2,4-difluorobenzene (PubChem CID 71089903) has the molecular formula C14H5BrF4 and a molecular weight of 329.09 g/mol. Its IUPAC name is 1-bromo-3-[2-(2,4-difluorophenyl)ethynyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[2-(2,4-difluorophenyl)ethynyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 71089903 |
| Molecular Formula | C14H5BrF4 |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 1-bromo-3-[2-(2,4-difluorophenyl)ethynyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(C#Cc2c(F)ccc(Br)c2F)c(F)c1 |
| InChI | InChI=1S/C14H5BrF4/c15-11-5-6-12(17)10(14(11)19)4-2-8-1-3-9(16)7-13(8)18/h1,3,5-7H |
| InChIKey | WAYFPZCERBCDIJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|