C14H17NO — CID 106208946
6-(1,3-dihydro-2-benzofuran-5-yl)hex-5-yn-1-amine (PubChem CID 106208946) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-(1,3-dihydro-2-benzofuran-5-yl)hex-5-yn-1-amine.
| Compound Name | 6-(1,3-dihydro-2-benzofuran-5-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106208946 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-(1,3-dihydro-2-benzofuran-5-yl)hex-5-yn-1-amine |
| SMILES | NCCCCC#Cc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C14H17NO/c15-8-4-2-1-3-5-12-6-7-13-10-16-11-14(13)9-12/h6-7,9H,1-2,4,8,10-11,15H2 |
| InChIKey | PQWJYWJZUHVTMH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|