C14H17N — CID 116641482
4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-3-yn-1-amine (PubChem CID 116641482) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-3-yn-1-amine.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 116641482 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-3-yn-1-amine |
| SMILES | NCCC#Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H17N/c15-10-4-3-5-12-8-9-13-6-1-2-7-14(13)11-12/h8-9,11H,1-2,4,6-7,10,15H2 |
| InChIKey | WUGQPKYDUIWTKZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|