C13H13Cl — CID 60800052
6-(3-chloroprop-1-ynyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 60800052) has the molecular formula C13H13Cl and a molecular weight of 204.70 g/mol. Its IUPAC name is 6-(3-chloroprop-1-ynyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(3-chloroprop-1-ynyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 60800052 |
| Molecular Formula | C13H13Cl |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-(3-chloroprop-1-ynyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClCC#Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H13Cl/c14-9-3-4-11-7-8-12-5-1-2-6-13(12)10-11/h7-8,10H,1-2,5-6,9H2 |
| InChIKey | ZHDOIPADYUUYQD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|