C13H12OS — CID 169487268
6-(3-sulfanylprop-1-ynyl)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 169487268) has the molecular formula C13H12OS and a molecular weight of 216.31 g/mol. Its IUPAC name is 6-(3-sulfanylprop-1-ynyl)-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-(3-sulfanylprop-1-ynyl)-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 169487268 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 6-(3-sulfanylprop-1-ynyl)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2cc(C#CCS)ccc2C1 |
| InChI | InChI=1S/C13H12OS/c14-13-6-5-11-8-10(2-1-7-15)3-4-12(11)9-13/h3-4,8,15H,5-7,9H2 |
| InChIKey | HNOXLBCWNHVKPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|