C13H11NO2 — CID 170473217
4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynamide (PubChem CID 170473217) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynamide.
| Compound Name | 4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynamide |
|---|---|
| PubChem CID | 170473217 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C13H11NO2/c14-13(16)3-1-2-9-4-5-10-6-7-12(15)11(10)8-9/h4-5,8H,3,6-7H2,(H2,14,16) |
| InChIKey | KIJRYPDEKORDQU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|