C11H6O3S — CID 169487270
5-(3-sulfanylprop-1-ynyl)-2-benzofuran-1,3-dione (PubChem CID 169487270) has the molecular formula C11H6O3S and a molecular weight of 218.23 g/mol. Its IUPAC name is 5-(3-sulfanylprop-1-ynyl)-2-benzofuran-1,3-dione.
| Compound Name | 5-(3-sulfanylprop-1-ynyl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 169487270 |
| Molecular Formula | C11H6O3S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 5-(3-sulfanylprop-1-ynyl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C#CCS)ccc21 |
| InChI | InChI=1S/C11H6O3S/c12-10-8-4-3-7(2-1-5-15)6-9(8)11(13)14-10/h3-4,6,15H,5H2 |
| InChIKey | DCFAFETULMMCKB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|