About N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine
N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine (PubChem CID 114164178) has the molecular formula C13H22BrN3
and a molecular weight of 300.24 g/mol. Its IUPAC name is N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine |
| PubChem CID | 114164178 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine |
| SMILES | CCC(CC)(CN)CNc1ccc(Br)c(C)n1 |
| InChI | InChI=1S/C13H22BrN3/c1-4-13(5-2,8-15)9-16-12-7-6-11(14)10(3)17-12/h6-7H,4-5,8-9,15H2,1-3H3,(H,16,17) |
| InChIKey | ZBCHLIPFEUWNDA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine?
The IUPAC name of N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine (CID 114164178) is N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine?
The canonical SMILES for N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine is CCC(CC)(CN)CNc1ccc(Br)c(C)n1.
What is the InChIKey of N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine?
The InChIKey is ZBCHLIPFEUWNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22BrN3/c1-4-13(5-2,8-15)9-16-12-7-6-11(14)10(3)17-12/h6-7H,4-5,8-9,15H2,1-3H3,(H,16,17).
What are the key properties of N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine?
N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine has a molecular weight of 300.24 g/mol, XLogP of 3.33, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-6-methyl-2-pyridinyl)-2,2-diethylpropane-1,3-diamine is sourced from PubChem (CID 114164178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).