C14H23BrN2 — CID 115148384
5-bromo-6-methyl-N-(2,2,3,3-tetramethylbutyl)pyridin-2-amine (PubChem CID 115148384) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 5-bromo-6-methyl-N-(2,2,3,3-tetramethylbutyl)pyridin-2-amine.
| Compound Name | 5-bromo-6-methyl-N-(2,2,3,3-tetramethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115148384 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-bromo-6-methyl-N-(2,2,3,3-tetramethylbutyl)pyridin-2-amine |
| SMILES | Cc1nc(NCC(C)(C)C(C)(C)C)ccc1Br |
| InChI | InChI=1S/C14H23BrN2/c1-10-11(15)7-8-12(17-10)16-9-14(5,6)13(2,3)4/h7-8H,9H2,1-6H3,(H,16,17) |
| InChIKey | YHKYLYIQDQXDAM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |