C12H26N2O3 — CID 114164684
4-methoxy-2-methyl-1-[(4-methylmorpholin-2-yl)methylamino]butan-2-ol (PubChem CID 114164684) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-[(4-methylmorpholin-2-yl)methylamino]butan-2-ol.
| Compound Name | 4-methoxy-2-methyl-1-[(4-methylmorpholin-2-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 114164684 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 4-methoxy-2-methyl-1-[(4-methylmorpholin-2-yl)methylamino]butan-2-ol |
| SMILES | COCCC(C)(O)CNCC1CN(C)CCO1 |
| InChI | InChI=1S/C12H26N2O3/c1-12(15,4-6-16-3)10-13-8-11-9-14(2)5-7-17-11/h11,13,15H,4-10H2,1-3H3 |
| InChIKey | JSTAPFUVCIQPKZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |