C11H20F2N2O3 — CID 114170037
N-[4-(aminomethyl)oxan-4-yl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 114170037) has the molecular formula C11H20F2N2O3 and a molecular weight of 266.29 g/mol. Its IUPAC name is N-[4-(aminomethyl)oxan-4-yl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[4-(aminomethyl)oxan-4-yl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 114170037 |
| Molecular Formula | C11H20F2N2O3 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[4-(aminomethyl)oxan-4-yl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | NCC1(NC(=O)CCOCC(F)F)CCOCC1 |
| InChI | InChI=1S/C11H20F2N2O3/c12-9(13)7-18-4-1-10(16)15-11(8-14)2-5-17-6-3-11/h9H,1-8,14H2,(H,15,16) |
| InChIKey | FTIRIIDKSLEVCP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|