C13H23IO4 — CID 11417355
methyl (1S,2R,3S)-2-(dimethoxymethyl)-3-(2-iodoethyl)cyclohexane-1-carboxylate (PubChem CID 11417355) has the molecular formula C13H23IO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is methyl (1S,2R,3S)-2-(dimethoxymethyl)-3-(2-iodoethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S)-2-(dimethoxymethyl)-3-(2-iodoethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11417355 |
| Molecular Formula | C13H23IO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | methyl (1S,2R,3S)-2-(dimethoxymethyl)-3-(2-iodoethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@@H](CCI)[C@H]1C(OC)OC |
| InChI | InChI=1S/C13H23IO4/c1-16-12(15)10-6-4-5-9(7-8-14)11(10)13(17-2)18-3/h9-11,13H,4-8H2,1-3H3/t9-,10-,11+/m0/s1 |
| InChIKey | OXDLNPVDAONKPG-GARJFASQSA-N |
| XLogP | 2.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|