About 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine
5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 114174333) has the molecular formula C14H21N3S
and a molecular weight of 263.41 g/mol. Its IUPAC name is 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 114174333 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C)(CC)Nc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C14H21N3S/c1-6-14(5,7-2)17-12-11-9(3)10(4)18-13(11)16-8-15-12/h8H,6-7H2,1-5H3,(H,15,16,17) |
| InChIKey | NJKUBGYPHHMQPD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine (CID 114174333) is 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine is CCC(C)(CC)Nc1ncnc2sc(C)c(C)c12.
What is the InChIKey of 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is NJKUBGYPHHMQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3S/c1-6-14(5,7-2)17-12-11-9(3)10(4)18-13(11)16-8-15-12/h8H,6-7H2,1-5H3,(H,15,16,17).
What are the key properties of 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine?
5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 263.41 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-N-(3-methylpentan-3-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 114174333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).