C12H13N3S — CID 115865541
N-but-2-ynyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 115865541) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-but-2-ynyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-but-2-ynyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115865541 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-but-2-ynyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC#CCNc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C12H13N3S/c1-4-5-6-13-11-10-8(2)9(3)16-12(10)15-7-14-11/h7H,6H2,1-3H3,(H,13,14,15) |
| InChIKey | WYLCYCRBYLCTOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|