C8H15N5O3S — CID 114174759
3-amino-N-[2-(dimethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 114174759) has the molecular formula C8H15N5O3S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 114174759 |
| Molecular Formula | C8H15N5O3S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C8H15N5O3S/c1-13(2)17(15,16)4-3-10-8(14)6-5-7(9)12-11-6/h5H,3-4H2,1-2H3,(H,10,14)(H3,9,11,12) |
| InChIKey | TUORLNUTQXWLJG-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |