C22H36O3Si — CID 11417548
cyclopentyl-bis(3-methoxyprop-1-ynyl)-non-1-en-4-yloxysilane (PubChem CID 11417548) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is cyclopentyl-bis(3-methoxyprop-1-ynyl)-non-1-en-4-yloxysilane.
| Compound Name | cyclopentyl-bis(3-methoxyprop-1-ynyl)-non-1-en-4-yloxysilane |
|---|---|
| PubChem CID | 11417548 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | cyclopentyl-bis(3-methoxyprop-1-ynyl)-non-1-en-4-yloxysilane |
| SMILES | C=CCC(CCCCC)O[Si](C#CCOC)(C#CCOC)C1CCCC1 |
| InChI | InChI=1S/C22H36O3Si/c1-5-7-8-14-21(13-6-2)25-26(19-11-17-23-3,20-12-18-24-4)22-15-9-10-16-22/h6,21-22H,2,5,7-10,13-18H2,1,3-4H3 |
| InChIKey | MDVCWIZVWHNPNF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|