C18H19NO6S — CID 11417564
methyl 2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate (PubChem CID 11417564) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate.
| Compound Name | methyl 2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 11417564 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
| SMILES | COC(=O)C12C=CC(=O)CC1CCN(S(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C18H19NO6S/c1-12-3-5-15(6-4-12)26(23,24)19-10-8-13-11-14(20)7-9-18(13,16(19)21)17(22)25-2/h3-7,9,13H,8,10-11H2,1-2H3 |
| InChIKey | KJKAYMMAYIWKBA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|