C12H19N3O3 — CID 114177080
4,4-dimethyl-3-[(3-nitro-4-pyridinyl)amino]pentan-1-ol (PubChem CID 114177080) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(3-nitro-4-pyridinyl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[(3-nitro-4-pyridinyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 114177080 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4,4-dimethyl-3-[(3-nitro-4-pyridinyl)amino]pentan-1-ol |
| SMILES | CC(C)(C)C(CCO)Nc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,3)11(5-7-16)14-9-4-6-13-8-10(9)15(17)18/h4,6,8,11,16H,5,7H2,1-3H3,(H,13,14) |
| InChIKey | GAVMFOCFBXWYSC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|