C9H11N3O5 — CID 62005492
methyl 3-hydroxy-2-[(3-nitro-4-pyridinyl)amino]propanoate (PubChem CID 62005492) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(3-nitro-4-pyridinyl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(3-nitro-4-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 62005492 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | methyl 3-hydroxy-2-[(3-nitro-4-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(CO)Nc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O5/c1-17-9(14)7(5-13)11-6-2-3-10-4-8(6)12(15)16/h2-4,7,13H,5H2,1H3,(H,10,11) |
| InChIKey | AONKSGIWKUBYKC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|