C9H10BrN3O5 — CID 103519781
methyl 2-[(3-bromo-5-nitro-4-pyridinyl)amino]-3-hydroxypropanoate (PubChem CID 103519781) has the molecular formula C9H10BrN3O5 and a molecular weight of 320.10 g/mol. Its IUPAC name is methyl 2-[(3-bromo-5-nitro-4-pyridinyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(3-bromo-5-nitro-4-pyridinyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 103519781 |
| Molecular Formula | C9H10BrN3O5 |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | methyl 2-[(3-bromo-5-nitro-4-pyridinyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)Nc1c(Br)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10BrN3O5/c1-18-9(15)6(4-14)12-8-5(10)2-11-3-7(8)13(16)17/h2-3,6,14H,4H2,1H3,(H,11,12) |
| InChIKey | FDDPDZUVOMMELR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|