C12H19BrN4O2 — CID 103519311
2-N-(3-bromo-5-nitro-4-pyridinyl)-1-N,1-N,3-trimethylbutane-1,2-diamine (PubChem CID 103519311) has the molecular formula C12H19BrN4O2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-N-(3-bromo-5-nitro-4-pyridinyl)-1-N,1-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 2-N-(3-bromo-5-nitro-4-pyridinyl)-1-N,1-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 103519311 |
| Molecular Formula | C12H19BrN4O2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-N-(3-bromo-5-nitro-4-pyridinyl)-1-N,1-N,3-trimethylbutane-1,2-diamine |
| SMILES | CC(C)C(CN(C)C)Nc1c(Br)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19BrN4O2/c1-8(2)10(7-16(3)4)15-12-9(13)5-14-6-11(12)17(18)19/h5-6,8,10H,7H2,1-4H3,(H,14,15) |
| InChIKey | PUFYYXIEHPIRPK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|