C11H12BrN3O2 — CID 114202605
3-bromo-N-(4-methylpent-1-yn-3-yl)-5-nitropyridin-4-amine (PubChem CID 114202605) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 3-bromo-N-(4-methylpent-1-yn-3-yl)-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-(4-methylpent-1-yn-3-yl)-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 114202605 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 3-bromo-N-(4-methylpent-1-yn-3-yl)-5-nitropyridin-4-amine |
| SMILES | C#CC(Nc1c(Br)cncc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C11H12BrN3O2/c1-4-9(7(2)3)14-11-8(12)5-13-6-10(11)15(16)17/h1,5-7,9H,2-3H3,(H,13,14) |
| InChIKey | IBMDMPDCCNAJJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|