C11H9BrN4O2 — CID 103519110
4-N-(3-bromo-5-nitro-4-pyridinyl)benzene-1,4-diamine (PubChem CID 103519110) has the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. Its IUPAC name is 4-N-(3-bromo-5-nitro-4-pyridinyl)benzene-1,4-diamine.
| Compound Name | 4-N-(3-bromo-5-nitro-4-pyridinyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 103519110 |
| Molecular Formula | C11H9BrN4O2 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 4-N-(3-bromo-5-nitro-4-pyridinyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2c(Br)cncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9BrN4O2/c12-9-5-14-6-10(16(17)18)11(9)15-8-3-1-7(13)2-4-8/h1-6H,13H2,(H,14,15) |
| InChIKey | KCXRJPQVBNYZIB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|