About ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate
ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate (PubChem CID 114177193) has the molecular formula C13H24N2O2S
and a molecular weight of 272.41 g/mol. Its IUPAC name is ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate |
| PubChem CID | 114177193 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC1=NC(C(C)(C)C)CCS1 |
| InChI | InChI=1S/C13H24N2O2S/c1-6-17-11(16)9(2)14-12-15-10(7-8-18-12)13(3,4)5/h9-10H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | UORRIXQERMNZHD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate?
The IUPAC name of ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate (CID 114177193) is ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate.
What is the SMILES notation for ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate?
The canonical SMILES for ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate is CCOC(=O)C(C)NC1=NC(C(C)(C)C)CCS1.
What is the InChIKey of ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate?
The InChIKey is UORRIXQERMNZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2S/c1-6-17-11(16)9(2)14-12-15-10(7-8-18-12)13(3,4)5/h9-10H,6-8H2,1-5H3,(H,14,15).
What are the key properties of ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate?
ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate has a molecular weight of 272.41 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]propanoate is sourced from PubChem (CID 114177193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).