C16H24ClNO — CID 114177536
1-chloro-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-methylpentan-3-amine (PubChem CID 114177536) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-chloro-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-methylpentan-3-amine.
| Compound Name | 1-chloro-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 114177536 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-chloro-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-methylpentan-3-amine |
| SMILES | CC(C)C(CCCl)NCC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H24ClNO/c1-12(2)15(7-9-17)18-11-13-8-10-19-16-6-4-3-5-14(13)16/h3-6,12-13,15,18H,7-11H2,1-2H3 |
| InChIKey | BDVBBVDEZBBAJL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|