C14H21ClN2O — CID 114177913
N-(1-chloro-4,4-dimethylpentan-3-yl)-6-methylpyridine-2-carboxamide (PubChem CID 114177913) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-6-methylpyridine-2-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 114177913 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)NC(CCCl)C(C)(C)C)n1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10-6-5-7-11(16-10)13(18)17-12(8-9-15)14(2,3)4/h5-7,12H,8-9H2,1-4H3,(H,17,18) |
| InChIKey | DRJWOUKXVMQUEU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|