C17H21ClN2O — CID 106355670
N-(1-chloro-4,4-dimethylpentan-3-yl)quinoline-2-carboxamide (PubChem CID 106355670) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)quinoline-2-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 106355670 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)quinoline-2-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H21ClN2O/c1-17(2,3)15(10-11-18)20-16(21)14-9-8-12-6-4-5-7-13(12)19-14/h4-9,15H,10-11H2,1-3H3,(H,20,21) |
| InChIKey | BMKZVPGEAXUVMA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|