C13H19N3S2 — CID 114179100
N-[2-(1,3-thiazol-2-yl)propan-2-yl]-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 114179100) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)propan-2-yl]-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-[2-(1,3-thiazol-2-yl)propan-2-yl]-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 114179100 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)propan-2-yl]-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | CC(C)(NC1=NC2CCCC2CS1)c1nccs1 |
| InChI | InChI=1S/C13H19N3S2/c1-13(2,11-14-6-7-17-11)16-12-15-10-5-3-4-9(10)8-18-12/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16) |
| InChIKey | ZSVUNPPRZUQKOS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |