C16H23NO — CID 114179150
3-(2,5-dimethylphenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine (PubChem CID 114179150) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine.
| Compound Name | 3-(2,5-dimethylphenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
|---|---|
| PubChem CID | 114179150 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
| SMILES | Cc1ccc(C)c(C2CNC3CCCC3CO2)c1 |
| InChI | InChI=1S/C16H23NO/c1-11-6-7-12(2)14(8-11)16-9-17-15-5-3-4-13(15)10-18-16/h6-8,13,15-17H,3-5,9-10H2,1-2H3 |
| InChIKey | AJOLZGKLBDXTEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |