C21H29NO6 — CID 11417929
1-O-tert-butyl 3-O-ethyl 3-(3-methoxy-2-methyl-3-oxopropyl)-2H-indole-1,3-dicarboxylate (PubChem CID 11417929) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-(3-methoxy-2-methyl-3-oxopropyl)-2H-indole-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-(3-methoxy-2-methyl-3-oxopropyl)-2H-indole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11417929 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-(3-methoxy-2-methyl-3-oxopropyl)-2H-indole-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(CC(C)C(=O)OC)CN(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H29NO6/c1-7-27-18(24)21(12-14(2)17(23)26-6)13-22(19(25)28-20(3,4)5)16-11-9-8-10-15(16)21/h8-11,14H,7,12-13H2,1-6H3 |
| InChIKey | FQDWFFNPNSMBGD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|