C13H15N3O3 — CID 114180877
methyl 4-amino-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzoate (PubChem CID 114180877) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 4-amino-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzoate.
| Compound Name | methyl 4-amino-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 114180877 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methyl 4-amino-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzoate |
| SMILES | COC(=O)c1ccc(N)c(NCc2ncc(C)o2)c1 |
| InChI | InChI=1S/C13H15N3O3/c1-8-6-16-12(19-8)7-15-11-5-9(13(17)18-2)3-4-10(11)14/h3-6,15H,7,14H2,1-2H3 |
| InChIKey | GMNKAGJVVZWWSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|