C14H18N4O2 — CID 170938282
methyl 4-amino-3-[(2,3-dimethylimidazol-4-yl)methylamino]benzoate (PubChem CID 170938282) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 4-amino-3-[(2,3-dimethylimidazol-4-yl)methylamino]benzoate.
| Compound Name | methyl 4-amino-3-[(2,3-dimethylimidazol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 170938282 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 4-amino-3-[(2,3-dimethylimidazol-4-yl)methylamino]benzoate |
| SMILES | COC(=O)c1ccc(N)c(NCc2cnc(C)n2C)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-9-16-7-11(18(9)2)8-17-13-6-10(14(19)20-3)4-5-12(13)15/h4-7,17H,8,15H2,1-3H3 |
| InChIKey | KRWNVMJEVHABNJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|