C9H10N4O5 — CID 114184071
(E)-4-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 114184071) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is (E)-4-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 114184071 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (E)-4-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C9H10N4O5/c14-6(1-2-8(15)16)13-9(17)10-4-3-7-11-5-12-18-7/h1-2,5H,3-4H2,(H,15,16)(H2,10,13,14,17)/b2-1+ |
| InChIKey | RHCILQFLXLRWCX-OWOJBTEDSA-N |
| XLogP | -0.92 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|