C26H38N2O2 — CID 11418428
1-[2-[4-(dimethylamino)piperidin-1-yl]-1-(6-methoxynaphthalen-2-yl)ethyl]cyclohexan-1-ol (PubChem CID 11418428) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 1-[2-[4-(dimethylamino)piperidin-1-yl]-1-(6-methoxynaphthalen-2-yl)ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[4-(dimethylamino)piperidin-1-yl]-1-(6-methoxynaphthalen-2-yl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11418428 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 1-[2-[4-(dimethylamino)piperidin-1-yl]-1-(6-methoxynaphthalen-2-yl)ethyl]cyclohexan-1-ol |
| SMILES | COc1ccc2cc(C(CN3CCC(N(C)C)CC3)C3(O)CCCCC3)ccc2c1 |
| InChI | InChI=1S/C26H38N2O2/c1-27(2)23-11-15-28(16-12-23)19-25(26(29)13-5-4-6-14-26)22-8-7-21-18-24(30-3)10-9-20(21)17-22/h7-10,17-18,23,25,29H,4-6,11-16,19H2,1-3H3 |
| InChIKey | CJZZWMSHMCFIFZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |